The reaction of cyanamide, NH2CN(s) with oxygen was run in a bomb calorimeter and U was found to be –742.24 kJ mol–1. The magnitude of ΔH298(KJ) for the given-below reaction is:

NH2CN(s) + \(\frac{3}{2}\)O2(g) → N2(g) + O2(g) + H2O(l) 

[Assume ideal gases and \(\mathrm{R}=8.314 \mathrm{~J} \mathrm{~mol}^{-1} \mathrm{~K}^{-1}\)]

1. 741 KJ 2. 745 KJ
3. 720 KJ 4. 734 KJ
Subtopic:  Enthalpy & Internal energy |
 70%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

The internal energy change (in kJ) when 90g of water undergoes complete evaporation at 100ºC is: 

(Given : Hvap for water at 373 K = 41 kJ/mol, R = 8.314 JK–1mol–1)

1. 154.5

2. 168.5

3. 176.5

4. 189.5

Subtopic:  Enthalpy & Internal energy |
 64%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

The heat of combustion of ethanol into carbon dioxides and water is –327 kcal at constant pressure. The heat evolved (in cal) at constant volume and 27°C (if all gases behave ideally) is:
(R = 2 cal mol–1 K–1)
1. 316 kcal
2. 326 kcal
3. 365 kcal
4. 342 kcal
Subtopic:  Enthalpy & Internal energy |
 79%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

For one mole of an ideal gas, which of these statements must be true?
(I) U and H each depend only on temperature.
(II) Compressibility factor z is not equal to 1.
(III) CP, m – CV, m = R
(IV) dU = CVdT for any process.
1. (I), (III) and (IV)
2. (II), (III) and (IV)
3. (III) and (IV)
4. (I) and (III)

Subtopic:  Enthalpy & Internal energy |
 54%
Level 3: 35%-60%
Hints

If, for a dimerization reaction, 2A(g) → A2(g)  at   298 K , ∆UΘ = -20 kJ mol-1   ∆SΘ   = - 30 J K-1mol-1 , then ∆GΘ  will be:

1. -10. 4 kJ

2. 18.9 kJ

3. -13.5 kJ

4. 17. 4 kJ

Subtopic:  Enthalpy & Internal energy | Gibbs Energy Change |
 68%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

What is the change in internal energy for 5 moles of an ideal gas when it undergoes reversible compression from 100 K to 200 K?
[Given CV = 28 J K–1 mol–1]​​​​​​

1. ΔU = 8kJ 2. ΔU = 14kJ
3. ΔU = 10kJ 4. ΔU = 2.8 kJ
Subtopic:  Enthalpy & Internal energy |
 90%
Level 1: 80%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

What is the difference between \(\Delta H\) and \(\Delta U\) \((\Delta H - \Delta U)\) when the combustion of one mole of heptane(l) is carried out at a temperature T?

1. 3RT 2. 4RT
3. – 3RT 4. – 4RT
Subtopic:  Enthalpy & Internal energy |
 55%
Level 3: 35%-60%
Please attempt this question first.
Hints
Please attempt this question first.

Enthalpy of sublimation of iodine is 24 cal g–1 at 200 °C. If specific heat of I2(s) and l2 (vap) are 0.055 and 0.031 cal g–1K–1 respectively, then enthalpy of sublimation of iodine at 250°C in cal g–1 is :
1.  2.85
2.  22.8
3.  11.4
4.  5.7

Subtopic:  Enthalpy & Internal energy |
 72%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

The value of enthalpy change (H) for the reaction

C2H5OH(1)+3O2(g)2CO2(g)+3H2O(l) at 27°C is -1366.5 kJ mol-1.

The value of internal energy change for the above reaction at this temperature will be:
1. –1369.0 k
2. –1364.0 kJ
3. –1361.5 k
4. 1371.5 kJ
Subtopic:  Enthalpy & Internal energy |
 73%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.

advertisementadvertisement

Assuming that water vapor is an ideal gas, the internal energy change (∆U) when 1 mol of water is vaporized at 1 bar pressure and 100°C, will be:

(Given: Molar enthalpy of vaporization of water at 1 bar and 373 K = 41 kJ mol–1 and R = 8.3 J mol–1 K–1

1. 4.100 kJ mol–1

2. 3.7904 kJ mol–1

3. 37.904 kJ mol–1

4. 41.00 kJ mol–1

Subtopic:  Enthalpy & Internal energy |
 76%
Level 2: 60%+
Please attempt this question first.
Hints
Please attempt this question first.